ਹੈਰੋਇਨ: ਰੀਵਿਜ਼ਨਾਂ ਵਿਚ ਫ਼ਰਕ
ਸਮੱਗਰੀ ਮਿਟਾਈ ਸਮੱਗਰੀ ਜੋੜੀ
Charan Gill (ਗੱਲ-ਬਾਤ | ਯੋਗਦਾਨ) ਛੋ added Category:ਨਸ਼ੀਲੀਆਂ ਦਵਾਈਆਂ using HotCat |
Charan Gill (ਗੱਲ-ਬਾਤ | ਯੋਗਦਾਨ) No edit summary |
||
ਲਾਈਨ 1:
{{drugbox
| Watchedfields = changed
| verifiedrevid = 443854562
| IUPAC_name = (5α,6α)-7,8-didehydro-4,5-epoxy-17-methylmorphinan-3,6-diol diacetate
| image = Heroin - Heroine.svg
| image2 = Heroin-from-xtal-horizontal-3D-balls.png
<!--Clinical data-->
| Drugs.com = {{drugs.com|parent|heroin}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU_comment =
| pregnancy_US = <!-- A / B / C / D / X / N -->
| pregnancy_US_comment =
| pregnancy_category =
| legal_AU = S9
| legal_CA = Schedule I
| legal_NZ = Class A
| legal_UK = Class A
| legal_US = Schedule I
| legal_UN = Narcotic Schedules I and IV
| dependency_liability = Physical: Very high<br />Psychological: Very high
| addiction_liability = Very high
| routes_of_administration = Inhalation, transmucosal, intravenous, oral, intranasal, rectal, intramuscular
<!--Pharmacokinetic data-->
| bioavailability = <35% (oral), 44–61% (inhaled)<ref name="pmid16433897">{{cite journal | author = Rook EJ, van Ree JM, van den Brink W, Hillebrand MJ, Huitema AD, Hendriks VM, Beijnen JH | title = Pharmacokinetics and pharmacodynamics of high doses of pharmaceutically prepared heroin, by intravenous or by inhalation route in opioid-dependent patients | journal = Basic Clin. Pharmacol. Toxicol. | volume = 98 | issue = 1 | pages = 86–96 | year = 2006 | pmid = 16433897 | doi = 10.1111/j.1742-7843.2006.pto_233.x }}</ref>
| protein_bound = 0% ([[morphine]] metabolite 35%)
| metabolism = [[hepatic]]
| elimination_half-life = 2–3 minutes<ref name = EMC>{{cite web|title=Diamorphine Hydrochloride Injection 30 mg – Summary of Product Characteristics|work=electronic Medicines Compendium|publisher=ViroPharma Limited|date=24 September 2013|accessdate=30 March 2014|url=http://www.medicines.org.uk/emc/medicine/28258/SPC/Diamorphine+Hydrochloride+Injection+30+mg/}}</ref>
| excretion = 90% [[renal]] as [[glucuronide]]s, rest [[biliary]]
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 561-27-3
| ATC_prefix = N07
| ATC_suffix = BC06
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 27808
| PubChem = 5462328
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01452
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 4575379
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8H672SHT8E
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 459324
<!--Chemical data-->
| C=21 | H=23 | N=1 | O=5
| molecular_weight = 369.41 g/mol
| smiles = CC(OC1=C(O[C@@H]2[C@]34CCN(C)[C@@H]([C@@H]4C=C[C@@H]2OC(C)=O)C5)C3=C5C=C1)=O
| InChI=1/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C21H23NO5/c1-11(23)25-16-6-4-13-10-15-14-5-7-17(26-12(2)24)20-21(14,8-9-22(15)3)18(13)19(16)27-20/h4-7,14-15,17,20H,8-10H2,1-3H3/t14-,15+,17-,20-,21-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = GVGLGOZIDCSQPN-PVHGPHFFSA-N
| synonyms = Diamorphine, Diacetylmorphine, Acetomorphine, (Dual) Acetylated morphine, Morphine diacetate
}}
'''ਹੈਰੋਇਨ''' ਇਕ ਦਵਾਈ ਹੈ ਜੋ ਪੋਸਤ ਦੇ ਬੂਟੇ ਤੋਂ ਬਣਦੀ ਹੈ। ਇਹ [[ਅਫ਼ੀਮ]] ਵਾਂਗ ਪੋਸਤ ਦੇ ਤਰਲ ਮਾਦੇ ਤੋਂ ਤਿਆਰ ਹੁੰਦੀ ਹੈ। ਇਹ ਨਸ਼ੀਲੀ ਹੈ ਅਤੇ ਇਸਦੀ ਲਤ ਬਹੁਤ ਛੇਤੀ ਲਗਦੀ ਹੈ। ਕਈ ਮੁਲਕਾਂ ਵਿੱਚ ਮੈਡੀਕਲ ਵਰਤੋਂ ਤੋਂ ਬਿਨਾਂ ਇਸ ਦੀ ਵਰਤੋਂ ਤੇ ਪਾਬੰਦੀ ਹੈ। ਇਹ ਚਿੱਟੇ ਜਾਂ ਭੂਰੇ ਰੰਗ ਦਾ ਪਾਊਡਰ ਹੁੰਦਾ ਹੈ ਜਿਸਦਾ ਧੂੰਆਂ ਪੀਤਾ ਜਾਂਦਾ ਹੈ ਜਾਂ ਸਿੱਧੇ ਹੀ ਸਰੀਰ ਵਿੱਚ ਦਾਖ਼ਲ ਕੀਤਾ ਜਾਂਦਾ ਹੈ।
|